C27H22N6O4 — CID 136865051
(7S)-5-methyl-7-(2-nitrophenyl)-3-N,6-N-diphenyl-4,7-dihydropyrazolo[1,5-a]pyrimidine-3,6-dicarboxamide (PubChem CID 136865051) has the molecular formula C27H22N6O4 and a molecular weight of 494.51 g/mol. Its IUPAC name is (7S)-5-methyl-7-(2-nitrophenyl)-3-N,6-N-diphenyl-4,7-dihydropyrazolo[1,5-a]pyrimidine-3,6-dicarboxamide.
| Compound Name | (7S)-5-methyl-7-(2-nitrophenyl)-3-N,6-N-diphenyl-4,7-dihydropyrazolo[1,5-a]pyrimidine-3,6-dicarboxamide |
|---|---|
| PubChem CID | 136865051 |
| Molecular Formula | C27H22N6O4 |
| Molecular Weight | 494.51 g/mol |
| Exact Mass | 494.17 |
| IUPAC Name | (7S)-5-methyl-7-(2-nitrophenyl)-3-N,6-N-diphenyl-4,7-dihydropyrazolo[1,5-a]pyrimidine-3,6-dicarboxamide |
| SMILES | CC1=C(C(=O)Nc2ccccc2)[C@H](c2ccccc2[N+](=O)[O-])n2ncc(C(=O)Nc3ccccc3)c2N1 |
| InChI | InChI=1S/C27H22N6O4/c1-17-23(27(35)31-19-12-6-3-7-13-19)24(20-14-8-9-15-22(20)33(36)37)32-25(29-17)21(16-28-32)26(34)30-18-10-4-2-5-11-18/h2-16,24,29H,1H3,(H,30,34)(H,31,35)/t24-/m0/s1 |
| InChIKey | SCZJDGYSOKPKGB-DEOSSOPVSA-N |
| XLogP | 4.97 |
| TPSA | 131.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.51 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|