C15H13N3O2 — CID 135411214
4-[(Z)-N-(1,3-benzoxazol-2-ylamino)-C-methylcarbonimidoyl]phenol (PubChem CID 135411214) has the molecular formula C15H13N3O2 and a molecular weight of 267.29 g/mol. Its IUPAC name is 4-[(Z)-N-(1,3-benzoxazol-2-ylamino)-C-methylcarbonimidoyl]phenol.
| Compound Name | 4-[(Z)-N-(1,3-benzoxazol-2-ylamino)-C-methylcarbonimidoyl]phenol |
|---|---|
| PubChem CID | 135411214 |
| Molecular Formula | C15H13N3O2 |
| Molecular Weight | 267.29 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | 4-[(Z)-N-(1,3-benzoxazol-2-ylamino)-C-methylcarbonimidoyl]phenol |
| SMILES | C/C(=N/Nc1nc2ccccc2o1)c1ccc(O)cc1 |
| InChI | InChI=1S/C15H13N3O2/c1-10(11-6-8-12(19)9-7-11)17-18-15-16-13-4-2-3-5-14(13)20-15/h2-9,19H,1H3,(H,16,18)/b17-10- |
| InChIKey | QZYPGTVKUYJBHK-YVLHZVERSA-N |
| XLogP | 3.37 |
| TPSA | 70.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.29 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|