C11H8N4OS — CID 135412360
5-phenyl-6-sulfanylidene-1,7-dihydropyrazolo[5,4-d]pyrimidin-4-one (PubChem CID 135412360) has the molecular formula C11H8N4OS and a molecular weight of 244.28 g/mol. Its IUPAC name is 5-phenyl-6-sulfanylidene-1,7-dihydropyrazolo[5,4-d]pyrimidin-4-one.
| Compound Name | 5-phenyl-6-sulfanylidene-1,7-dihydropyrazolo[5,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135412360 |
| Molecular Formula | C11H8N4OS |
| Molecular Weight | 244.28 g/mol |
| Exact Mass | 244.04 |
| IUPAC Name | 5-phenyl-6-sulfanylidene-1,7-dihydropyrazolo[5,4-d]pyrimidin-4-one |
| SMILES | O=c1c2cn[nH]c2[nH]c(=S)n1-c1ccccc1 |
| InChI | InChI=1S/C11H8N4OS/c16-10-8-6-12-14-9(8)13-11(17)15(10)7-4-2-1-3-5-7/h1-6H,(H2,12,13,14,17) |
| InChIKey | PLUVWHRAFOQZME-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 66.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.28 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|