C11H7ClN4OS — CID 135433193
5-(2-chlorophenyl)-6-sulfanylidene-1,7-dihydropyrazolo[5,4-d]pyrimidin-4-one (PubChem CID 135433193) has the molecular formula C11H7ClN4OS and a molecular weight of 278.72 g/mol. Its IUPAC name is 5-(2-chlorophenyl)-6-sulfanylidene-1,7-dihydropyrazolo[5,4-d]pyrimidin-4-one.
| Compound Name | 5-(2-chlorophenyl)-6-sulfanylidene-1,7-dihydropyrazolo[5,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135433193 |
| Molecular Formula | C11H7ClN4OS |
| Molecular Weight | 278.72 g/mol |
| Exact Mass | 278.00 |
| IUPAC Name | 5-(2-chlorophenyl)-6-sulfanylidene-1,7-dihydropyrazolo[5,4-d]pyrimidin-4-one |
| SMILES | O=c1c2cn[nH]c2[nH]c(=S)n1-c1ccccc1Cl |
| InChI | InChI=1S/C11H7ClN4OS/c12-7-3-1-2-4-8(7)16-10(17)6-5-13-15-9(6)14-11(16)18/h1-5H,(H2,13,14,15,18) |
| InChIKey | LSTGHYWASJWJHG-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 66.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.72 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|