C12H7ClN6O — CID 3072259
10-(4-chlorophenyl)-1,5,6,8,10,12-hexazatricyclo[7.3.0.03,7]dodeca-3(7),4,8,11-tetraen-2-one (PubChem CID 3072259) has the molecular formula C12H7ClN6O and a molecular weight of 286.68 g/mol. Its IUPAC name is 10-(4-chlorophenyl)-1,5,6,8,10,12-hexazatricyclo[7.3.0.03,7]dodeca-3(7),4,8,11-tetraen-2-one.
| Compound Name | 10-(4-chlorophenyl)-1,5,6,8,10,12-hexazatricyclo[7.3.0.03,7]dodeca-3(7),4,8,11-tetraen-2-one |
|---|---|
| PubChem CID | 3072259 |
| Molecular Formula | C12H7ClN6O |
| Molecular Weight | 286.68 g/mol |
| Exact Mass | 286.04 |
| IUPAC Name | 10-(4-chlorophenyl)-1,5,6,8,10,12-hexazatricyclo[7.3.0.03,7]dodeca-3(7),4,8,11-tetraen-2-one |
| SMILES | O=c1c2cn[nH]c2nc2n(-c3ccc(Cl)cc3)cnn12 |
| InChI | InChI=1S/C12H7ClN6O/c13-7-1-3-8(4-2-7)18-6-15-19-11(20)9-5-14-17-10(9)16-12(18)19/h1-6H,(H,14,17) |
| InChIKey | KVMUJUGVKGHKSN-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 80.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.68 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |