C12H14N2O4S — CID 135412577
5,5-bis(hydroxymethyl)-2-(4-methoxyphenyl)imino-1,3-thiazolidin-4-one (PubChem CID 135412577) has the molecular formula C12H14N2O4S and a molecular weight of 282.32 g/mol. Its IUPAC name is 5,5-bis(hydroxymethyl)-2-(4-methoxyphenyl)imino-1,3-thiazolidin-4-one.
| Compound Name | 5,5-bis(hydroxymethyl)-2-(4-methoxyphenyl)imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135412577 |
| Molecular Formula | C12H14N2O4S |
| Molecular Weight | 282.32 g/mol |
| Exact Mass | 282.07 |
| IUPAC Name | 5,5-bis(hydroxymethyl)-2-(4-methoxyphenyl)imino-1,3-thiazolidin-4-one |
| SMILES | COc1ccc(/N=C2\NC(=O)C(CO)(CO)S2)cc1 |
| InChI | InChI=1S/C12H14N2O4S/c1-18-9-4-2-8(3-5-9)13-11-14-10(17)12(6-15,7-16)19-11/h2-5,15-16H,6-7H2,1H3,(H,13,14,17) |
| InChIKey | RHOVUVPUVPYXOS-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 91.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.32 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|