C14H12N2O2 — CID 135412693
7-(1-methylpyrrol-2-yl)quinoline-5,8-diol (PubChem CID 135412693) has the molecular formula C14H12N2O2 and a molecular weight of 240.26 g/mol. Its IUPAC name is 7-(1-methylpyrrol-2-yl)quinoline-5,8-diol.
| Compound Name | 7-(1-methylpyrrol-2-yl)quinoline-5,8-diol |
|---|---|
| PubChem CID | 135412693 |
| Molecular Formula | C14H12N2O2 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.09 |
| IUPAC Name | 7-(1-methylpyrrol-2-yl)quinoline-5,8-diol |
| SMILES | Cn1cccc1-c1cc(O)c2cccnc2c1O |
| InChI | InChI=1S/C14H12N2O2/c1-16-7-3-5-11(16)10-8-12(17)9-4-2-6-15-13(9)14(10)18/h2-8,17-18H,1H3 |
| InChIKey | KQSSMTFTSIUDCT-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|