C14H14N4O — CID 135412716
6-ethyl-3-methyl-4-phenyl-2H-pyrazolo[3,4-d]pyridazin-7-one (PubChem CID 135412716) has the molecular formula C14H14N4O and a molecular weight of 254.29 g/mol. Its IUPAC name is 6-ethyl-3-methyl-4-phenyl-2H-pyrazolo[3,4-d]pyridazin-7-one.
| Compound Name | 6-ethyl-3-methyl-4-phenyl-2H-pyrazolo[3,4-d]pyridazin-7-one |
|---|---|
| PubChem CID | 135412716 |
| Molecular Formula | C14H14N4O |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | 6-ethyl-3-methyl-4-phenyl-2H-pyrazolo[3,4-d]pyridazin-7-one |
| SMILES | CCn1nc(-c2ccccc2)c2c(C)[nH]nc2c1=O |
| InChI | InChI=1S/C14H14N4O/c1-3-18-14(19)13-11(9(2)15-16-13)12(17-18)10-7-5-4-6-8-10/h4-8H,3H2,1-2H3,(H,15,16) |
| InChIKey | GFZGIBACYLJUKV-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |