C23H20N6O2S2 — CID 135413724
4-(methoxymethyl)-6-methyl-3-pyrrol-1-yl-N-[(E)-(3-thiophen-2-yl-1H-pyrazol-5-yl)methylideneamino]thieno[2,3-b]pyridine-2-carboxamide (PubChem CID 135413724) has the molecular formula C23H20N6O2S2 and a molecular weight of 476.59 g/mol. Its IUPAC name is 4-(methoxymethyl)-6-methyl-3-pyrrol-1-yl-N-[(E)-(3-thiophen-2-yl-1H-pyrazol-5-yl)methylideneamino]thieno[2,3-b]pyridine-2-carboxamide.
| Compound Name | 4-(methoxymethyl)-6-methyl-3-pyrrol-1-yl-N-[(E)-(3-thiophen-2-yl-1H-pyrazol-5-yl)methylideneamino]thieno[2,3-b]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 135413724 |
| Molecular Formula | C23H20N6O2S2 |
| Molecular Weight | 476.59 g/mol |
| Exact Mass | 476.11 |
| IUPAC Name | 4-(methoxymethyl)-6-methyl-3-pyrrol-1-yl-N-[(E)-(3-thiophen-2-yl-1H-pyrazol-5-yl)methylideneamino]thieno[2,3-b]pyridine-2-carboxamide |
| SMILES | COCc1cc(C)nc2sc(C(=O)N/N=C/c3cc(-c4cccs4)n[nH]3)c(-n3cccc3)c12 |
| InChI | InChI=1S/C23H20N6O2S2/c1-14-10-15(13-31-2)19-20(29-7-3-4-8-29)21(33-23(19)25-14)22(30)28-24-12-16-11-17(27-26-16)18-6-5-9-32-18/h3-12H,13H2,1-2H3,(H,26,27)(H,28,30)/b24-12+ |
| InChIKey | FLOTVBODAOTHBG-WYMPLXKRSA-N |
| XLogP | 4.76 |
| TPSA | 97.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.59 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|