C21H16Cl2N4OS — CID 171132016
N-[(3,4-dichlorophenyl)methylideneamino]-4,6-dimethyl-3-pyrrol-1-ylthieno[2,3-b]pyridine-2-carboxamide (PubChem CID 171132016) has the molecular formula C21H16Cl2N4OS and a molecular weight of 443.36 g/mol. Its IUPAC name is N-[(3,4-dichlorophenyl)methylideneamino]-4,6-dimethyl-3-pyrrol-1-ylthieno[2,3-b]pyridine-2-carboxamide.
| Compound Name | N-[(3,4-dichlorophenyl)methylideneamino]-4,6-dimethyl-3-pyrrol-1-ylthieno[2,3-b]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 171132016 |
| Molecular Formula | C21H16Cl2N4OS |
| Molecular Weight | 443.36 g/mol |
| Exact Mass | 442.04 |
| IUPAC Name | N-[(3,4-dichlorophenyl)methylideneamino]-4,6-dimethyl-3-pyrrol-1-ylthieno[2,3-b]pyridine-2-carboxamide |
| SMILES | Cc1cc(C)c2c(-n3cccc3)c(C(=O)NN=Cc3ccc(Cl)c(Cl)c3)sc2n1 |
| InChI | InChI=1S/C21H16Cl2N4OS/c1-12-9-13(2)25-21-17(12)18(27-7-3-4-8-27)19(29-21)20(28)26-24-11-14-5-6-15(22)16(23)10-14/h3-11H,1-2H3,(H,26,28) |
| InChIKey | PNMGNDDWKIFKAI-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 59.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.36 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|