C26H24N4O4S — CID 6324291
3-[(2-methoxybenzoyl)amino]-N-[(Z)-(4-methoxyphenyl)methylideneamino]-4,6-dimethylthieno[2,3-b]pyridine-2-carboxamide (PubChem CID 6324291) has the molecular formula C26H24N4O4S and a molecular weight of 488.57 g/mol. Its IUPAC name is 3-[(2-methoxybenzoyl)amino]-N-[(Z)-(4-methoxyphenyl)methylideneamino]-4,6-dimethylthieno[2,3-b]pyridine-2-carboxamide.
| Compound Name | 3-[(2-methoxybenzoyl)amino]-N-[(Z)-(4-methoxyphenyl)methylideneamino]-4,6-dimethylthieno[2,3-b]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 6324291 |
| Molecular Formula | C26H24N4O4S |
| Molecular Weight | 488.57 g/mol |
| Exact Mass | 488.15 |
| IUPAC Name | 3-[(2-methoxybenzoyl)amino]-N-[(Z)-(4-methoxyphenyl)methylideneamino]-4,6-dimethylthieno[2,3-b]pyridine-2-carboxamide |
| SMILES | COc1ccc(/C=N\NC(=O)c2sc3nc(C)cc(C)c3c2NC(=O)c2ccccc2OC)cc1 |
| InChI | InChI=1S/C26H24N4O4S/c1-15-13-16(2)28-26-21(15)22(29-24(31)19-7-5-6-8-20(19)34-4)23(35-26)25(32)30-27-14-17-9-11-18(33-3)12-10-17/h5-14H,1-4H3,(H,29,31)(H,30,32)/b27-14- |
| InChIKey | OOLJJNLLVZQLNX-VYYCAZPPSA-N |
| XLogP | 4.95 |
| TPSA | 101.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.57 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|