C25H34N5O7P — CID 135414298
(2S)-2-[[4-[2-(2-amino-4-oxo-3,7-dihydropyrrolo[2,3-d]pyrimidin-6-yl)ethyl]benzoyl]amino]-6-diethoxyphosphorylhexanoic acid (PubChem CID 135414298) has the molecular formula C25H34N5O7P and a molecular weight of 547.55 g/mol. Its IUPAC name is (2S)-2-[[4-[2-(2-amino-4-oxo-3,7-dihydropyrrolo[2,3-d]pyrimidin-6-yl)ethyl]benzoyl]amino]-6-diethoxyphosphorylhexanoic acid.
| Compound Name | (2S)-2-[[4-[2-(2-amino-4-oxo-3,7-dihydropyrrolo[2,3-d]pyrimidin-6-yl)ethyl]benzoyl]amino]-6-diethoxyphosphorylhexanoic acid |
|---|---|
| PubChem CID | 135414298 |
| Molecular Formula | C25H34N5O7P |
| Molecular Weight | 547.55 g/mol |
| Exact Mass | 547.22 |
| IUPAC Name | (2S)-2-[[4-[2-(2-amino-4-oxo-3,7-dihydropyrrolo[2,3-d]pyrimidin-6-yl)ethyl]benzoyl]amino]-6-diethoxyphosphorylhexanoic acid |
| SMILES | CCOP(=O)(CCCC[C@H](NC(=O)c1ccc(CCc2cc3c(=O)[nH]c(N)nc3[nH]2)cc1)C(=O)O)OCC |
| InChI | InChI=1S/C25H34N5O7P/c1-3-36-38(35,37-4-2)14-6-5-7-20(24(33)34)28-22(31)17-11-8-16(9-12-17)10-13-18-15-19-21(27-18)29-25(26)30-23(19)32/h8-9,11-12,15,20H,3-7,10,13-14H2,1-2H3,(H,28,31)(H,33,34)(H4,26,27,29,30,32)/t20-/m0/s1 |
| InChIKey | KWVGRJAMMVUBCQ-FQEVSTJZSA-N |
| XLogP | 3.24 |
| TPSA | 189.49 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.55 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|