C23H21N5O3S — CID 135415459
ethyl 2-[(Z)-3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl]sulfanyl-1-ethylbenzimidazole-5-carboxylate (PubChem CID 135415459) has the molecular formula C23H21N5O3S and a molecular weight of 447.52 g/mol. Its IUPAC name is ethyl 2-[(Z)-3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl]sulfanyl-1-ethylbenzimidazole-5-carboxylate.
| Compound Name | ethyl 2-[(Z)-3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl]sulfanyl-1-ethylbenzimidazole-5-carboxylate |
|---|---|
| PubChem CID | 135415459 |
| Molecular Formula | C23H21N5O3S |
| Molecular Weight | 447.52 g/mol |
| Exact Mass | 447.14 |
| IUPAC Name | ethyl 2-[(Z)-3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl]sulfanyl-1-ethylbenzimidazole-5-carboxylate |
| SMILES | CCOC(=O)c1ccc2c(c1)nc(SC/C(O)=C(\C#N)c1nc3ccccc3[nH]1)n2CC |
| InChI | InChI=1S/C23H21N5O3S/c1-3-28-19-10-9-14(22(30)31-4-2)11-18(19)27-23(28)32-13-20(29)15(12-24)21-25-16-7-5-6-8-17(16)26-21/h5-11,29H,3-4,13H2,1-2H3,(H,25,26)/b20-15- |
| InChIKey | KBVZPDQZZNZOGF-HKWRFOASSA-N |
| XLogP | 4.69 |
| TPSA | 116.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.52 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|