C16H16N4O3 — CID 135418225
ethyl 4-[3-amino-4-(3-aminophenyl)-1,2-oxazol-5-yl]-1H-pyrrole-2-carboxylate (PubChem CID 135418225) has the molecular formula C16H16N4O3 and a molecular weight of 312.33 g/mol. Its IUPAC name is ethyl 4-[3-amino-4-(3-aminophenyl)-1,2-oxazol-5-yl]-1H-pyrrole-2-carboxylate.
| Compound Name | ethyl 4-[3-amino-4-(3-aminophenyl)-1,2-oxazol-5-yl]-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 135418225 |
| Molecular Formula | C16H16N4O3 |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | ethyl 4-[3-amino-4-(3-aminophenyl)-1,2-oxazol-5-yl]-1H-pyrrole-2-carboxylate |
| SMILES | CCOC(=O)c1cc(-c2onc(N)c2-c2cccc(N)c2)c[nH]1 |
| InChI | InChI=1S/C16H16N4O3/c1-2-22-16(21)12-7-10(8-19-12)14-13(15(18)20-23-14)9-4-3-5-11(17)6-9/h3-8,19H,2,17H2,1H3,(H2,18,20) |
| InChIKey | HALUHNSGBXITER-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 120.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|