C15H17ClN2O3S — CID 135419265
6-[2-(4-chlorophenyl)imino-4-oxo-1,3-thiazolidin-5-yl]hexanoic acid (PubChem CID 135419265) has the molecular formula C15H17ClN2O3S and a molecular weight of 340.83 g/mol. Its IUPAC name is 6-[2-(4-chlorophenyl)imino-4-oxo-1,3-thiazolidin-5-yl]hexanoic acid.
| Compound Name | 6-[2-(4-chlorophenyl)imino-4-oxo-1,3-thiazolidin-5-yl]hexanoic acid |
|---|---|
| PubChem CID | 135419265 |
| Molecular Formula | C15H17ClN2O3S |
| Molecular Weight | 340.83 g/mol |
| Exact Mass | 340.06 |
| IUPAC Name | 6-[2-(4-chlorophenyl)imino-4-oxo-1,3-thiazolidin-5-yl]hexanoic acid |
| SMILES | O=C(O)CCCCCC1S/C(=N\c2ccc(Cl)cc2)NC1=O |
| InChI | InChI=1S/C15H17ClN2O3S/c16-10-6-8-11(9-7-10)17-15-18-14(21)12(22-15)4-2-1-3-5-13(19)20/h6-9,12H,1-5H2,(H,19,20)(H,17,18,21) |
| InChIKey | UDHQGZGVGMYYPK-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 78.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.83 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|