C18H17ClN2OS — CID 135707402
5-[(4-chlorophenyl)methyl]-2-(4-ethylphenyl)imino-1,3-thiazolidin-4-one (PubChem CID 135707402) has the molecular formula C18H17ClN2OS and a molecular weight of 344.87 g/mol. Its IUPAC name is 5-[(4-chlorophenyl)methyl]-2-(4-ethylphenyl)imino-1,3-thiazolidin-4-one.
| Compound Name | 5-[(4-chlorophenyl)methyl]-2-(4-ethylphenyl)imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135707402 |
| Molecular Formula | C18H17ClN2OS |
| Molecular Weight | 344.87 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | 5-[(4-chlorophenyl)methyl]-2-(4-ethylphenyl)imino-1,3-thiazolidin-4-one |
| SMILES | CCc1ccc(/N=C2/NC(=O)C(Cc3ccc(Cl)cc3)S2)cc1 |
| InChI | InChI=1S/C18H17ClN2OS/c1-2-12-5-9-15(10-6-12)20-18-21-17(22)16(23-18)11-13-3-7-14(19)8-4-13/h3-10,16H,2,11H2,1H3,(H,20,21,22) |
| InChIKey | AVTKQQZFKRLKEU-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.87 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|