C20H22N2OS — CID 135707347
2-(4-methylphenyl)imino-5-[(4-propan-2-ylphenyl)methyl]-1,3-thiazolidin-4-one (PubChem CID 135707347) has the molecular formula C20H22N2OS and a molecular weight of 338.48 g/mol. Its IUPAC name is 2-(4-methylphenyl)imino-5-[(4-propan-2-ylphenyl)methyl]-1,3-thiazolidin-4-one.
| Compound Name | 2-(4-methylphenyl)imino-5-[(4-propan-2-ylphenyl)methyl]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135707347 |
| Molecular Formula | C20H22N2OS |
| Molecular Weight | 338.48 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | 2-(4-methylphenyl)imino-5-[(4-propan-2-ylphenyl)methyl]-1,3-thiazolidin-4-one |
| SMILES | Cc1ccc(/N=C2\NC(=O)C(Cc3ccc(C(C)C)cc3)S2)cc1 |
| InChI | InChI=1S/C20H22N2OS/c1-13(2)16-8-6-15(7-9-16)12-18-19(23)22-20(24-18)21-17-10-4-14(3)5-11-17/h4-11,13,18H,12H2,1-3H3,(H,21,22,23) |
| InChIKey | GACMQJCLKIRAPR-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.48 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|