C17H14Cl2N2OS — CID 136720879
(5R)-5-[(2,3-dichlorophenyl)methyl]-2-(4-methylphenyl)imino-1,3-thiazolidin-4-one (PubChem CID 136720879) has the molecular formula C17H14Cl2N2OS and a molecular weight of 365.29 g/mol. Its IUPAC name is (5R)-5-[(2,3-dichlorophenyl)methyl]-2-(4-methylphenyl)imino-1,3-thiazolidin-4-one.
| Compound Name | (5R)-5-[(2,3-dichlorophenyl)methyl]-2-(4-methylphenyl)imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 136720879 |
| Molecular Formula | C17H14Cl2N2OS |
| Molecular Weight | 365.29 g/mol |
| Exact Mass | 364.02 |
| IUPAC Name | (5R)-5-[(2,3-dichlorophenyl)methyl]-2-(4-methylphenyl)imino-1,3-thiazolidin-4-one |
| SMILES | Cc1ccc(/N=C2/NC(=O)[C@@H](Cc3cccc(Cl)c3Cl)S2)cc1 |
| InChI | InChI=1S/C17H14Cl2N2OS/c1-10-5-7-12(8-6-10)20-17-21-16(22)14(23-17)9-11-3-2-4-13(18)15(11)19/h2-8,14H,9H2,1H3,(H,20,21,22)/t14-/m1/s1 |
| InChIKey | BBTPZZLFGAQXKS-CQSZACIVSA-N |
| XLogP | 4.76 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.29 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|