C20H21ClN2OS — CID 135707373
5-[(4-butylphenyl)methyl]-2-(4-chlorophenyl)imino-1,3-thiazolidin-4-one (PubChem CID 135707373) has the molecular formula C20H21ClN2OS and a molecular weight of 372.92 g/mol. Its IUPAC name is 5-[(4-butylphenyl)methyl]-2-(4-chlorophenyl)imino-1,3-thiazolidin-4-one.
| Compound Name | 5-[(4-butylphenyl)methyl]-2-(4-chlorophenyl)imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135707373 |
| Molecular Formula | C20H21ClN2OS |
| Molecular Weight | 372.92 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | 5-[(4-butylphenyl)methyl]-2-(4-chlorophenyl)imino-1,3-thiazolidin-4-one |
| SMILES | CCCCc1ccc(CC2S/C(=N\c3ccc(Cl)cc3)NC2=O)cc1 |
| InChI | InChI=1S/C20H21ClN2OS/c1-2-3-4-14-5-7-15(8-6-14)13-18-19(24)23-20(25-18)22-17-11-9-16(21)10-12-17/h5-12,18H,2-4,13H2,1H3,(H,22,23,24) |
| InChIKey | YGJOBEIZQKFBML-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.92 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|