C20H18ClF3N2OS — CID 135707423
5-[[2-chloro-5-(trifluoromethyl)phenyl]methyl]-2-(4-propan-2-ylphenyl)imino-1,3-thiazolidin-4-one (PubChem CID 135707423) has the molecular formula C20H18ClF3N2OS and a molecular weight of 426.89 g/mol. Its IUPAC name is 5-[[2-chloro-5-(trifluoromethyl)phenyl]methyl]-2-(4-propan-2-ylphenyl)imino-1,3-thiazolidin-4-one.
| Compound Name | 5-[[2-chloro-5-(trifluoromethyl)phenyl]methyl]-2-(4-propan-2-ylphenyl)imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135707423 |
| Molecular Formula | C20H18ClF3N2OS |
| Molecular Weight | 426.89 g/mol |
| Exact Mass | 426.08 |
| IUPAC Name | 5-[[2-chloro-5-(trifluoromethyl)phenyl]methyl]-2-(4-propan-2-ylphenyl)imino-1,3-thiazolidin-4-one |
| SMILES | CC(C)c1ccc(/N=C2\NC(=O)C(Cc3cc(C(F)(F)F)ccc3Cl)S2)cc1 |
| InChI | InChI=1S/C20H18ClF3N2OS/c1-11(2)12-3-6-15(7-4-12)25-19-26-18(27)17(28-19)10-13-9-14(20(22,23)24)5-8-16(13)21/h3-9,11,17H,10H2,1-2H3,(H,25,26,27) |
| InChIKey | WAUXBAMKTIYJMQ-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.89 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|