C24H17N5O4 — CID 135419409
1-[(4-nitrophenyl)methylideneamino]-8-phenylmethoxy-3,5-dihydropyridazino[4,5-b]indol-4-one (PubChem CID 135419409) has the molecular formula C24H17N5O4 and a molecular weight of 439.43 g/mol. Its IUPAC name is 1-[(4-nitrophenyl)methylideneamino]-8-phenylmethoxy-3,5-dihydropyridazino[4,5-b]indol-4-one.
| Compound Name | 1-[(4-nitrophenyl)methylideneamino]-8-phenylmethoxy-3,5-dihydropyridazino[4,5-b]indol-4-one |
|---|---|
| PubChem CID | 135419409 |
| Molecular Formula | C24H17N5O4 |
| Molecular Weight | 439.43 g/mol |
| Exact Mass | 439.13 |
| IUPAC Name | 1-[(4-nitrophenyl)methylideneamino]-8-phenylmethoxy-3,5-dihydropyridazino[4,5-b]indol-4-one |
| SMILES | O=c1[nH]nc(/N=C/c2ccc([N+](=O)[O-])cc2)c2c1[nH]c1ccc(OCc3ccccc3)cc12 |
| InChI | InChI=1S/C24H17N5O4/c30-24-22-21(23(27-28-24)25-13-15-6-8-17(9-7-15)29(31)32)19-12-18(10-11-20(19)26-22)33-14-16-4-2-1-3-5-16/h1-13,26H,14H2,(H,28,30)/b25-13+ |
| InChIKey | PTDJSYNTRUBWTL-DHRITJCHSA-N |
| XLogP | 4.64 |
| TPSA | 126.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.43 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|