C17H21NO2 — CID 135421534
3-hydroxy-5,5-dimethyl-2-(2-phenylethyliminomethyl)cyclohex-2-en-1-one (PubChem CID 135421534) has the molecular formula C17H21NO2 and a molecular weight of 271.36 g/mol. Its IUPAC name is 3-hydroxy-5,5-dimethyl-2-(2-phenylethyliminomethyl)cyclohex-2-en-1-one.
| Compound Name | 3-hydroxy-5,5-dimethyl-2-(2-phenylethyliminomethyl)cyclohex-2-en-1-one |
|---|---|
| PubChem CID | 135421534 |
| Molecular Formula | C17H21NO2 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.16 |
| IUPAC Name | 3-hydroxy-5,5-dimethyl-2-(2-phenylethyliminomethyl)cyclohex-2-en-1-one |
| SMILES | CC1(C)CC(=O)C(/C=N/CCc2ccccc2)=C(O)C1 |
| InChI | InChI=1S/C17H21NO2/c1-17(2)10-15(19)14(16(20)11-17)12-18-9-8-13-6-4-3-5-7-13/h3-7,12,19H,8-11H2,1-2H3/b18-12+ |
| InChIKey | CMRJAIABGHJEMJ-LDADJPATSA-N |
| XLogP | 3.50 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|