C19H17ClN2O4 — CID 135424415
2-(4-chlorophenoxy)ethyl 3-(4-oxo-3H-quinazolin-2-yl)propanoate (PubChem CID 135424415) has the molecular formula C19H17ClN2O4 and a molecular weight of 372.81 g/mol. Its IUPAC name is 2-(4-chlorophenoxy)ethyl 3-(4-oxo-3H-quinazolin-2-yl)propanoate.
| Compound Name | 2-(4-chlorophenoxy)ethyl 3-(4-oxo-3H-quinazolin-2-yl)propanoate |
|---|---|
| PubChem CID | 135424415 |
| Molecular Formula | C19H17ClN2O4 |
| Molecular Weight | 372.81 g/mol |
| Exact Mass | 372.09 |
| IUPAC Name | 2-(4-chlorophenoxy)ethyl 3-(4-oxo-3H-quinazolin-2-yl)propanoate |
| SMILES | O=C(CCc1nc2ccccc2c(=O)[nH]1)OCCOc1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H17ClN2O4/c20-13-5-7-14(8-6-13)25-11-12-26-18(23)10-9-17-21-16-4-2-1-3-15(16)19(24)22-17/h1-8H,9-12H2,(H,21,22,24) |
| InChIKey | SMQLSENRPXIGOQ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 81.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.81 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|