C21H20IN3O4S — CID 135424720
3-(1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-yl)-4-hydroxy-6-iodo-1-(3-methylbutyl)quinolin-2-one (PubChem CID 135424720) has the molecular formula C21H20IN3O4S and a molecular weight of 537.38 g/mol. Its IUPAC name is 3-(1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-yl)-4-hydroxy-6-iodo-1-(3-methylbutyl)quinolin-2-one.
| Compound Name | 3-(1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-yl)-4-hydroxy-6-iodo-1-(3-methylbutyl)quinolin-2-one |
|---|---|
| PubChem CID | 135424720 |
| Molecular Formula | C21H20IN3O4S |
| Molecular Weight | 537.38 g/mol |
| Exact Mass | 537.02 |
| IUPAC Name | 3-(1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-yl)-4-hydroxy-6-iodo-1-(3-methylbutyl)quinolin-2-one |
| SMILES | CC(C)CCn1c(=O)c(C2=NS(=O)(=O)c3ccccc3N2)c(O)c2cc(I)ccc21 |
| InChI | InChI=1S/C21H20IN3O4S/c1-12(2)9-10-25-16-8-7-13(22)11-14(16)19(26)18(21(25)27)20-23-15-5-3-4-6-17(15)30(28,29)24-20/h3-8,11-12,26H,9-10H2,1-2H3,(H,23,24) |
| InChIKey | LPCUJXQYRGLQFI-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 100.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.38 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|