C13H17N3OS — CID 135425031
(2E)-2-(2-adamantylidenehydrazinylidene)-1,3-thiazolidin-4-one (PubChem CID 135425031) has the molecular formula C13H17N3OS and a molecular weight of 263.37 g/mol. Its IUPAC name is (2E)-2-(2-adamantylidenehydrazinylidene)-1,3-thiazolidin-4-one.
| Compound Name | (2E)-2-(2-adamantylidenehydrazinylidene)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135425031 |
| Molecular Formula | C13H17N3OS |
| Molecular Weight | 263.37 g/mol |
| Exact Mass | 263.11 |
| IUPAC Name | (2E)-2-(2-adamantylidenehydrazinylidene)-1,3-thiazolidin-4-one |
| SMILES | O=C1CS/C(=N/N=C2C3CC4CC(C3)CC2C4)N1 |
| InChI | InChI=1S/C13H17N3OS/c17-11-6-18-13(14-11)16-15-12-9-2-7-1-8(4-9)5-10(12)3-7/h7-10H,1-6H2,(H,14,16,17)/b15-12- |
| InChIKey | GRQFKZOXHUGPKM-QINSGFPZSA-N |
| XLogP | 2.02 |
| TPSA | 53.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.37 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|