C9H7FN2OS — CID 135426081
2-(4-fluorophenyl)imino-1,3-thiazolidin-4-one (PubChem CID 135426081) has the molecular formula C9H7FN2OS and a molecular weight of 210.23 g/mol. Its IUPAC name is 2-(4-fluorophenyl)imino-1,3-thiazolidin-4-one.
| Compound Name | 2-(4-fluorophenyl)imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135426081 |
| Molecular Formula | C9H7FN2OS |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.03 |
| IUPAC Name | 2-(4-fluorophenyl)imino-1,3-thiazolidin-4-one |
| SMILES | O=C1CS/C(=N\c2ccc(F)cc2)N1 |
| InChI | InChI=1S/C9H7FN2OS/c10-6-1-3-7(4-2-6)11-9-12-8(13)5-14-9/h1-4H,5H2,(H,11,12,13) |
| InChIKey | ABBIJUYBGHHPFV-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|