C9H8N2OS — CID 135406265
2-phenylimino-1,3-thiazolidin-4-one (PubChem CID 135406265) has the molecular formula C9H8N2OS and a molecular weight of 192.24 g/mol. Its IUPAC name is 2-phenylimino-1,3-thiazolidin-4-one.
| Compound Name | 2-phenylimino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135406265 |
| Molecular Formula | C9H8N2OS |
| Molecular Weight | 192.24 g/mol |
| Exact Mass | 192.04 |
| IUPAC Name | 2-phenylimino-1,3-thiazolidin-4-one |
| SMILES | O=C1CS/C(=N\c2ccccc2)N1 |
| InChI | InChI=1S/C9H8N2OS/c12-8-6-13-9(11-8)10-7-4-2-1-3-5-7/h1-5H,6H2,(H,10,11,12) |
| InChIKey | IYGBTPGRKGQPLW-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.24 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|