C11H10ClN3OS — CID 135427712
4-amino-2-[(3-chlorophenyl)methylsulfanyl]-1H-pyrimidin-6-one (PubChem CID 135427712) has the molecular formula C11H10ClN3OS and a molecular weight of 267.74 g/mol. Its IUPAC name is 4-amino-2-[(3-chlorophenyl)methylsulfanyl]-1H-pyrimidin-6-one.
| Compound Name | 4-amino-2-[(3-chlorophenyl)methylsulfanyl]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 135427712 |
| Molecular Formula | C11H10ClN3OS |
| Molecular Weight | 267.74 g/mol |
| Exact Mass | 267.02 |
| IUPAC Name | 4-amino-2-[(3-chlorophenyl)methylsulfanyl]-1H-pyrimidin-6-one |
| SMILES | Nc1cc(=O)[nH]c(SCc2cccc(Cl)c2)n1 |
| InChI | InChI=1S/C11H10ClN3OS/c12-8-3-1-2-7(4-8)6-17-11-14-9(13)5-10(16)15-11/h1-5H,6H2,(H3,13,14,15,16) |
| InChIKey | ATGRTSBOPIQKIQ-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.74 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |