C17H16FN5O2 — CID 135428841
(6-fluoro-3-pyridinyl)-[(3S)-3-[3-(1H-pyrrol-2-yl)-1,2,4-oxadiazol-5-yl]piperidin-1-yl]methanone (PubChem CID 135428841) has the molecular formula C17H16FN5O2 and a molecular weight of 341.35 g/mol. Its IUPAC name is (6-fluoro-3-pyridinyl)-[(3S)-3-[3-(1H-pyrrol-2-yl)-1,2,4-oxadiazol-5-yl]piperidin-1-yl]methanone.
| Compound Name | (6-fluoro-3-pyridinyl)-[(3S)-3-[3-(1H-pyrrol-2-yl)-1,2,4-oxadiazol-5-yl]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 135428841 |
| Molecular Formula | C17H16FN5O2 |
| Molecular Weight | 341.35 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | (6-fluoro-3-pyridinyl)-[(3S)-3-[3-(1H-pyrrol-2-yl)-1,2,4-oxadiazol-5-yl]piperidin-1-yl]methanone |
| SMILES | O=C(c1ccc(F)nc1)N1CCC[C@H](c2nc(-c3ccc[nH]3)no2)C1 |
| InChI | InChI=1S/C17H16FN5O2/c18-14-6-5-11(9-20-14)17(24)23-8-2-3-12(10-23)16-21-15(22-25-16)13-4-1-7-19-13/h1,4-7,9,12,19H,2-3,8,10H2/t12-/m0/s1 |
| InChIKey | RIYADNUXTBLENX-LBPRGKRZSA-N |
| XLogP | 2.62 |
| TPSA | 87.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.35 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|