C17H11N3O2 — CID 135429338
1-(3-pyridin-2-yl-1,2,4-oxadiazol-5-yl)naphthalen-2-ol (PubChem CID 135429338) has the molecular formula C17H11N3O2 and a molecular weight of 289.29 g/mol. Its IUPAC name is 1-(3-pyridin-2-yl-1,2,4-oxadiazol-5-yl)naphthalen-2-ol.
| Compound Name | 1-(3-pyridin-2-yl-1,2,4-oxadiazol-5-yl)naphthalen-2-ol |
|---|---|
| PubChem CID | 135429338 |
| Molecular Formula | C17H11N3O2 |
| Molecular Weight | 289.29 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | 1-(3-pyridin-2-yl-1,2,4-oxadiazol-5-yl)naphthalen-2-ol |
| SMILES | Oc1ccc2ccccc2c1-c1nc(-c2ccccn2)no1 |
| InChI | InChI=1S/C17H11N3O2/c21-14-9-8-11-5-1-2-6-12(11)15(14)17-19-16(20-22-17)13-7-3-4-10-18-13/h1-10,21H |
| InChIKey | PFTKEDZRQCTDDT-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 72.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.29 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |