C12H7ClN4O — CID 30028861
5-(6-chloro-3-pyridinyl)-3-pyridin-2-yl-1,2,4-oxadiazole (PubChem CID 30028861) has the molecular formula C12H7ClN4O and a molecular weight of 258.67 g/mol. Its IUPAC name is 5-(6-chloro-3-pyridinyl)-3-pyridin-2-yl-1,2,4-oxadiazole.
| Compound Name | 5-(6-chloro-3-pyridinyl)-3-pyridin-2-yl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 30028861 |
| Molecular Formula | C12H7ClN4O |
| Molecular Weight | 258.67 g/mol |
| Exact Mass | 258.03 |
| IUPAC Name | 5-(6-chloro-3-pyridinyl)-3-pyridin-2-yl-1,2,4-oxadiazole |
| SMILES | Clc1ccc(-c2nc(-c3ccccn3)no2)cn1 |
| InChI | InChI=1S/C12H7ClN4O/c13-10-5-4-8(7-15-10)12-16-11(17-18-12)9-3-1-2-6-14-9/h1-7H |
| InChIKey | XFPMOUQQPUQZLP-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 64.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.67 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|