C14H7ClF3N3O — CID 1472030
5-(6-chloro-3-pyridinyl)-3-[4-(trifluoromethyl)phenyl]-1,2,4-oxadiazole (PubChem CID 1472030) has the molecular formula C14H7ClF3N3O and a molecular weight of 325.68 g/mol. Its IUPAC name is 5-(6-chloro-3-pyridinyl)-3-[4-(trifluoromethyl)phenyl]-1,2,4-oxadiazole.
| Compound Name | 5-(6-chloro-3-pyridinyl)-3-[4-(trifluoromethyl)phenyl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 1472030 |
| Molecular Formula | C14H7ClF3N3O |
| Molecular Weight | 325.68 g/mol |
| Exact Mass | 325.02 |
| IUPAC Name | 5-(6-chloro-3-pyridinyl)-3-[4-(trifluoromethyl)phenyl]-1,2,4-oxadiazole |
| SMILES | FC(F)(F)c1ccc(-c2noc(-c3ccc(Cl)nc3)n2)cc1 |
| InChI | InChI=1S/C14H7ClF3N3O/c15-11-6-3-9(7-19-11)13-20-12(21-22-13)8-1-4-10(5-2-8)14(16,17)18/h1-7H |
| InChIKey | MQZOVTJIHCZHAC-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.68 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|