C16H22N6O3 — CID 135430543
2-amino-4-[[(2S)-2-(benzylamino)pentyl]amino]-5-nitro-1H-pyrimidin-6-one (PubChem CID 135430543) has the molecular formula C16H22N6O3 and a molecular weight of 346.39 g/mol. Its IUPAC name is 2-amino-4-[[(2S)-2-(benzylamino)pentyl]amino]-5-nitro-1H-pyrimidin-6-one.
| Compound Name | 2-amino-4-[[(2S)-2-(benzylamino)pentyl]amino]-5-nitro-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 135430543 |
| Molecular Formula | C16H22N6O3 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | 2-amino-4-[[(2S)-2-(benzylamino)pentyl]amino]-5-nitro-1H-pyrimidin-6-one |
| SMILES | CCC[C@@H](CNc1nc(N)[nH]c(=O)c1[N+](=O)[O-])NCc1ccccc1 |
| InChI | InChI=1S/C16H22N6O3/c1-2-6-12(18-9-11-7-4-3-5-8-11)10-19-14-13(22(24)25)15(23)21-16(17)20-14/h3-5,7-8,12,18H,2,6,9-10H2,1H3,(H4,17,19,20,21,23)/t12-/m0/s1 |
| InChIKey | WJRXBYWTPCAZND-LBPRGKRZSA-N |
| XLogP | 1.63 |
| TPSA | 138.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|