C15H23BrN4O2 — CID 135430593
(2S)-1-[(E)-(7-bromo-2,3-dihydro-1H-1,8-naphthyridin-4-ylidene)amino]oxy-3-(tert-butylamino)propan-2-ol (PubChem CID 135430593) has the molecular formula C15H23BrN4O2 and a molecular weight of 371.28 g/mol. Its IUPAC name is (2S)-1-[(E)-(7-bromo-2,3-dihydro-1H-1,8-naphthyridin-4-ylidene)amino]oxy-3-(tert-butylamino)propan-2-ol.
| Compound Name | (2S)-1-[(E)-(7-bromo-2,3-dihydro-1H-1,8-naphthyridin-4-ylidene)amino]oxy-3-(tert-butylamino)propan-2-ol |
|---|---|
| PubChem CID | 135430593 |
| Molecular Formula | C15H23BrN4O2 |
| Molecular Weight | 371.28 g/mol |
| Exact Mass | 370.10 |
| IUPAC Name | (2S)-1-[(E)-(7-bromo-2,3-dihydro-1H-1,8-naphthyridin-4-ylidene)amino]oxy-3-(tert-butylamino)propan-2-ol |
| SMILES | CC(C)(C)NC[C@H](O)CO/N=C1\CCNc2nc(Br)ccc21 |
| InChI | InChI=1S/C15H23BrN4O2/c1-15(2,3)18-8-10(21)9-22-20-12-6-7-17-14-11(12)4-5-13(16)19-14/h4-5,10,18,21H,6-9H2,1-3H3,(H,17,19)/b20-12+/t10-/m0/s1 |
| InChIKey | GAOAGWQQQXDGQB-WBWSGGQMSA-N |
| XLogP | 2.13 |
| TPSA | 78.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.28 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|