C15H22Br2N4O2 — CID 135462404
(2R)-1-(tert-butylamino)-3-[(E)-(6,7-dibromo-2,3-dihydro-1H-1,8-naphthyridin-4-ylidene)amino]oxypropan-2-ol (PubChem CID 135462404) has the molecular formula C15H22Br2N4O2 and a molecular weight of 450.18 g/mol. Its IUPAC name is (2R)-1-(tert-butylamino)-3-[(E)-(6,7-dibromo-2,3-dihydro-1H-1,8-naphthyridin-4-ylidene)amino]oxypropan-2-ol.
| Compound Name | (2R)-1-(tert-butylamino)-3-[(E)-(6,7-dibromo-2,3-dihydro-1H-1,8-naphthyridin-4-ylidene)amino]oxypropan-2-ol |
|---|---|
| PubChem CID | 135462404 |
| Molecular Formula | C15H22Br2N4O2 |
| Molecular Weight | 450.18 g/mol |
| Exact Mass | 448.01 |
| IUPAC Name | (2R)-1-(tert-butylamino)-3-[(E)-(6,7-dibromo-2,3-dihydro-1H-1,8-naphthyridin-4-ylidene)amino]oxypropan-2-ol |
| SMILES | CC(C)(C)NC[C@@H](O)CO/N=C1\CCNc2nc(Br)c(Br)cc21 |
| InChI | InChI=1S/C15H22Br2N4O2/c1-15(2,3)19-7-9(22)8-23-21-12-4-5-18-14-10(12)6-11(16)13(17)20-14/h6,9,19,22H,4-5,7-8H2,1-3H3,(H,18,20)/b21-12+/t9-/m1/s1 |
| InChIKey | XQXQRIPQTMLYCX-FSHZFVGBSA-N |
| XLogP | 2.89 |
| TPSA | 78.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.18 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|