C19H24N6O4S — CID 135430829
2-[5-(4-methylpiperazin-1-yl)sulfonyl-2-propoxyphenyl]-1,7-dihydropurin-6-one (PubChem CID 135430829) has the molecular formula C19H24N6O4S and a molecular weight of 432.51 g/mol. Its IUPAC name is 2-[5-(4-methylpiperazin-1-yl)sulfonyl-2-propoxyphenyl]-1,7-dihydropurin-6-one.
| Compound Name | 2-[5-(4-methylpiperazin-1-yl)sulfonyl-2-propoxyphenyl]-1,7-dihydropurin-6-one |
|---|---|
| PubChem CID | 135430829 |
| Molecular Formula | C19H24N6O4S |
| Molecular Weight | 432.51 g/mol |
| Exact Mass | 432.16 |
| IUPAC Name | 2-[5-(4-methylpiperazin-1-yl)sulfonyl-2-propoxyphenyl]-1,7-dihydropurin-6-one |
| SMILES | CCCOc1ccc(S(=O)(=O)N2CCN(C)CC2)cc1-c1nc2nc[nH]c2c(=O)[nH]1 |
| InChI | InChI=1S/C19H24N6O4S/c1-3-10-29-15-5-4-13(30(27,28)25-8-6-24(2)7-9-25)11-14(15)17-22-18-16(19(26)23-17)20-12-21-18/h4-5,11-12H,3,6-10H2,1-2H3,(H2,20,21,22,23,26) |
| InChIKey | XZWLDPKIKIDQTB-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 124.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.51 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |