C23H32N6O5S — CID 22174721
8-[2-butoxy-5-(4-methylpiperazin-1-yl)sulfonylphenyl]-3-propyl-7H-purine-2,6-dione (PubChem CID 22174721) has the molecular formula C23H32N6O5S and a molecular weight of 504.61 g/mol. Its IUPAC name is 8-[2-butoxy-5-(4-methylpiperazin-1-yl)sulfonylphenyl]-3-propyl-7H-purine-2,6-dione.
| Compound Name | 8-[2-butoxy-5-(4-methylpiperazin-1-yl)sulfonylphenyl]-3-propyl-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 22174721 |
| Molecular Formula | C23H32N6O5S |
| Molecular Weight | 504.61 g/mol |
| Exact Mass | 504.22 |
| IUPAC Name | 8-[2-butoxy-5-(4-methylpiperazin-1-yl)sulfonylphenyl]-3-propyl-7H-purine-2,6-dione |
| SMILES | CCCCOc1ccc(S(=O)(=O)N2CCN(C)CC2)cc1-c1nc2c([nH]1)c(=O)[nH]c(=O)n2CCC |
| InChI | InChI=1S/C23H32N6O5S/c1-4-6-14-34-18-8-7-16(35(32,33)28-12-10-27(3)11-13-28)15-17(18)20-24-19-21(25-20)29(9-5-2)23(31)26-22(19)30/h7-8,15H,4-6,9-14H2,1-3H3,(H,24,25)(H,26,30,31) |
| InChIKey | KSOPSBVJSMYNIZ-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 133.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.61 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|