C24H32N8O5S — CID 135788370
8-[2-butoxy-5-[4-(2-hydroxyethyl)piperazin-1-yl]sulfonylphenyl]-6-ethyl-9H-[1,2,4]triazolo[3,4-f]purin-5-one (PubChem CID 135788370) has the molecular formula C24H32N8O5S and a molecular weight of 544.64 g/mol. Its IUPAC name is 8-[2-butoxy-5-[4-(2-hydroxyethyl)piperazin-1-yl]sulfonylphenyl]-6-ethyl-9H-[1,2,4]triazolo[3,4-f]purin-5-one.
| Compound Name | 8-[2-butoxy-5-[4-(2-hydroxyethyl)piperazin-1-yl]sulfonylphenyl]-6-ethyl-9H-[1,2,4]triazolo[3,4-f]purin-5-one |
|---|---|
| PubChem CID | 135788370 |
| Molecular Formula | C24H32N8O5S |
| Molecular Weight | 544.64 g/mol |
| Exact Mass | 544.22 |
| IUPAC Name | 8-[2-butoxy-5-[4-(2-hydroxyethyl)piperazin-1-yl]sulfonylphenyl]-6-ethyl-9H-[1,2,4]triazolo[3,4-f]purin-5-one |
| SMILES | CCCCOc1ccc(S(=O)(=O)N2CCN(CCO)CC2)cc1-c1nc2c([nH]1)c1nncn1c(=O)n2CC |
| InChI | InChI=1S/C24H32N8O5S/c1-3-5-14-37-19-7-6-17(38(35,36)30-10-8-29(9-11-30)12-13-33)15-18(19)21-26-20-22(27-21)31(4-2)24(34)32-16-25-28-23(20)32/h6-7,15-16,33H,3-5,8-14H2,1-2H3,(H,26,27) |
| InChIKey | BLAZZSUESKDBIZ-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 150.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.64 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|