About 4-oxo-3H-pyrazolo[1,5-a][1,3,5]triazine-8-carbonitrile
4-oxo-3H-pyrazolo[1,5-a][1,3,5]triazine-8-carbonitrile (PubChem CID 135432415) has the molecular formula C6H3N5O
and a molecular weight of 161.12 g/mol. Its IUPAC name is 4-oxo-3H-pyrazolo[1,5-a][1,3,5]triazine-8-carbonitrile.
Analyze 4-oxo-3H-pyrazolo[1,5-a][1,3,5]triazine-8-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-oxo-3H-pyrazolo[1,5-a][1,3,5]triazine-8-carbonitrile?
The IUPAC name of 4-oxo-3H-pyrazolo[1,5-a][1,3,5]triazine-8-carbonitrile (CID 135432415) is 4-oxo-3H-pyrazolo[1,5-a][1,3,5]triazine-8-carbonitrile.
What is the SMILES notation for 4-oxo-3H-pyrazolo[1,5-a][1,3,5]triazine-8-carbonitrile?
The canonical SMILES for 4-oxo-3H-pyrazolo[1,5-a][1,3,5]triazine-8-carbonitrile is N#Cc1cnn2c(=O)[nH]cnc12.
What is the InChIKey of 4-oxo-3H-pyrazolo[1,5-a][1,3,5]triazine-8-carbonitrile?
The InChIKey is WKLFOEXJOITUBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H3N5O/c7-1-4-2-10-11-5(4)8-3-9-6(11)12/h2-3H,(H,8,9,12).
What are the key properties of 4-oxo-3H-pyrazolo[1,5-a][1,3,5]triazine-8-carbonitrile?
4-oxo-3H-pyrazolo[1,5-a][1,3,5]triazine-8-carbonitrile has a molecular weight of 161.12 g/mol, XLogP of -0.71, 0 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-oxo-3H-pyrazolo[1,5-a][1,3,5]triazine-8-carbonitrile is sourced from PubChem (CID 135432415), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).