C16H10F3NO2 — CID 135432882
4-[4-phenyl-5-(trifluoromethyl)-1,2-oxazol-3-yl]phenol (PubChem CID 135432882) has the molecular formula C16H10F3NO2 and a molecular weight of 305.26 g/mol. Its IUPAC name is 4-[4-phenyl-5-(trifluoromethyl)-1,2-oxazol-3-yl]phenol.
| Compound Name | 4-[4-phenyl-5-(trifluoromethyl)-1,2-oxazol-3-yl]phenol |
|---|---|
| PubChem CID | 135432882 |
| Molecular Formula | C16H10F3NO2 |
| Molecular Weight | 305.26 g/mol |
| Exact Mass | 305.07 |
| IUPAC Name | 4-[4-phenyl-5-(trifluoromethyl)-1,2-oxazol-3-yl]phenol |
| SMILES | Oc1ccc(-c2noc(C(F)(F)F)c2-c2ccccc2)cc1 |
| InChI | InChI=1S/C16H10F3NO2/c17-16(18,19)15-13(10-4-2-1-3-5-10)14(20-22-15)11-6-8-12(21)9-7-11/h1-9,21H |
| InChIKey | ZRHZEPFBMCFVEY-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.26 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |