C21H26N4O4S — CID 135433140
2-(2-butoxy-5-methylsulfonylphenyl)-7-ethyl-5-prop-2-enyl-3H-imidazo[5,1-f][1,2,4]triazin-4-one (PubChem CID 135433140) has the molecular formula C21H26N4O4S and a molecular weight of 430.53 g/mol. Its IUPAC name is 2-(2-butoxy-5-methylsulfonylphenyl)-7-ethyl-5-prop-2-enyl-3H-imidazo[5,1-f][1,2,4]triazin-4-one.
| Compound Name | 2-(2-butoxy-5-methylsulfonylphenyl)-7-ethyl-5-prop-2-enyl-3H-imidazo[5,1-f][1,2,4]triazin-4-one |
|---|---|
| PubChem CID | 135433140 |
| Molecular Formula | C21H26N4O4S |
| Molecular Weight | 430.53 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | 2-(2-butoxy-5-methylsulfonylphenyl)-7-ethyl-5-prop-2-enyl-3H-imidazo[5,1-f][1,2,4]triazin-4-one |
| SMILES | C=CCc1nc(CC)n2nc(-c3cc(S(C)(=O)=O)ccc3OCCCC)[nH]c(=O)c12 |
| InChI | InChI=1S/C21H26N4O4S/c1-5-8-12-29-17-11-10-14(30(4,27)28)13-15(17)20-23-21(26)19-16(9-6-2)22-18(7-3)25(19)24-20/h6,10-11,13H,2,5,7-9,12H2,1,3-4H3,(H,23,24,26) |
| InChIKey | WOMAWMQHDOEHAU-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 106.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.53 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|