C24H33ClN4O4S — CID 135552967
3-[7-(2-ethylheptyl)-5-methyl-4-oxo-3H-imidazo[5,1-f][1,2,4]triazin-2-yl]-4-propoxybenzenesulfonyl chloride (PubChem CID 135552967) has the molecular formula C24H33ClN4O4S and a molecular weight of 509.07 g/mol. Its IUPAC name is 3-[7-(2-ethylheptyl)-5-methyl-4-oxo-3H-imidazo[5,1-f][1,2,4]triazin-2-yl]-4-propoxybenzenesulfonyl chloride.
| Compound Name | 3-[7-(2-ethylheptyl)-5-methyl-4-oxo-3H-imidazo[5,1-f][1,2,4]triazin-2-yl]-4-propoxybenzenesulfonyl chloride |
|---|---|
| PubChem CID | 135552967 |
| Molecular Formula | C24H33ClN4O4S |
| Molecular Weight | 509.07 g/mol |
| Exact Mass | 508.19 |
| IUPAC Name | 3-[7-(2-ethylheptyl)-5-methyl-4-oxo-3H-imidazo[5,1-f][1,2,4]triazin-2-yl]-4-propoxybenzenesulfonyl chloride |
| SMILES | CCCCCC(CC)Cc1nc(C)c2c(=O)[nH]c(-c3cc(S(=O)(=O)Cl)ccc3OCCC)nn12 |
| InChI | InChI=1S/C24H33ClN4O4S/c1-5-8-9-10-17(7-3)14-21-26-16(4)22-24(30)27-23(28-29(21)22)19-15-18(34(25,31)32)11-12-20(19)33-13-6-2/h11-12,15,17H,5-10,13-14H2,1-4H3,(H,27,28,30) |
| InChIKey | HDMIFAMWGNGBJW-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 106.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.07 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|