C27H31Cl2N5O4S — CID 135769906
N-(3,5-dichlorophenyl)-4-ethoxy-3-(7-heptyl-5-methyl-4-oxo-3H-imidazo[5,1-f][1,2,4]triazin-2-yl)benzenesulfonamide (PubChem CID 135769906) has the molecular formula C27H31Cl2N5O4S and a molecular weight of 592.55 g/mol. Its IUPAC name is N-(3,5-dichlorophenyl)-4-ethoxy-3-(7-heptyl-5-methyl-4-oxo-3H-imidazo[5,1-f][1,2,4]triazin-2-yl)benzenesulfonamide.
| Compound Name | N-(3,5-dichlorophenyl)-4-ethoxy-3-(7-heptyl-5-methyl-4-oxo-3H-imidazo[5,1-f][1,2,4]triazin-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 135769906 |
| Molecular Formula | C27H31Cl2N5O4S |
| Molecular Weight | 592.55 g/mol |
| Exact Mass | 591.15 |
| IUPAC Name | N-(3,5-dichlorophenyl)-4-ethoxy-3-(7-heptyl-5-methyl-4-oxo-3H-imidazo[5,1-f][1,2,4]triazin-2-yl)benzenesulfonamide |
| SMILES | CCCCCCCc1nc(C)c2c(=O)[nH]c(-c3cc(S(=O)(=O)Nc4cc(Cl)cc(Cl)c4)ccc3OCC)nn12 |
| InChI | InChI=1S/C27H31Cl2N5O4S/c1-4-6-7-8-9-10-24-30-17(3)25-27(35)31-26(32-34(24)25)22-16-21(11-12-23(22)38-5-2)39(36,37)33-20-14-18(28)13-19(29)15-20/h11-16,33H,4-10H2,1-3H3,(H,31,32,35) |
| InChIKey | QSUJOMCKWKHULO-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 118.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.55 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|