C27H34N6O4S — CID 135769938
N-[4-(dimethylamino)phenyl]-4-ethoxy-3-(5-methyl-4-oxo-7-pentyl-3H-imidazo[5,1-f][1,2,4]triazin-2-yl)benzenesulfonamide (PubChem CID 135769938) has the molecular formula C27H34N6O4S and a molecular weight of 538.67 g/mol. Its IUPAC name is N-[4-(dimethylamino)phenyl]-4-ethoxy-3-(5-methyl-4-oxo-7-pentyl-3H-imidazo[5,1-f][1,2,4]triazin-2-yl)benzenesulfonamide.
| Compound Name | N-[4-(dimethylamino)phenyl]-4-ethoxy-3-(5-methyl-4-oxo-7-pentyl-3H-imidazo[5,1-f][1,2,4]triazin-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 135769938 |
| Molecular Formula | C27H34N6O4S |
| Molecular Weight | 538.67 g/mol |
| Exact Mass | 538.24 |
| IUPAC Name | N-[4-(dimethylamino)phenyl]-4-ethoxy-3-(5-methyl-4-oxo-7-pentyl-3H-imidazo[5,1-f][1,2,4]triazin-2-yl)benzenesulfonamide |
| SMILES | CCCCCc1nc(C)c2c(=O)[nH]c(-c3cc(S(=O)(=O)Nc4ccc(N(C)C)cc4)ccc3OCC)nn12 |
| InChI | InChI=1S/C27H34N6O4S/c1-6-8-9-10-24-28-18(3)25-27(34)29-26(30-33(24)25)22-17-21(15-16-23(22)37-7-2)38(35,36)31-19-11-13-20(14-12-19)32(4)5/h11-17,31H,6-10H2,1-5H3,(H,29,30,34) |
| InChIKey | PQVRVFPVFZLARR-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 121.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.67 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|