C26H30ClN5O4S — CID 135769931
N-(4-chlorophenyl)-4-ethoxy-3-(7-hexyl-5-methyl-4-oxo-3H-imidazo[5,1-f][1,2,4]triazin-2-yl)benzenesulfonamide (PubChem CID 135769931) has the molecular formula C26H30ClN5O4S and a molecular weight of 544.08 g/mol. Its IUPAC name is N-(4-chlorophenyl)-4-ethoxy-3-(7-hexyl-5-methyl-4-oxo-3H-imidazo[5,1-f][1,2,4]triazin-2-yl)benzenesulfonamide.
| Compound Name | N-(4-chlorophenyl)-4-ethoxy-3-(7-hexyl-5-methyl-4-oxo-3H-imidazo[5,1-f][1,2,4]triazin-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 135769931 |
| Molecular Formula | C26H30ClN5O4S |
| Molecular Weight | 544.08 g/mol |
| Exact Mass | 543.17 |
| IUPAC Name | N-(4-chlorophenyl)-4-ethoxy-3-(7-hexyl-5-methyl-4-oxo-3H-imidazo[5,1-f][1,2,4]triazin-2-yl)benzenesulfonamide |
| SMILES | CCCCCCc1nc(C)c2c(=O)[nH]c(-c3cc(S(=O)(=O)Nc4ccc(Cl)cc4)ccc3OCC)nn12 |
| InChI | InChI=1S/C26H30ClN5O4S/c1-4-6-7-8-9-23-28-17(3)24-26(33)29-25(30-32(23)24)21-16-20(14-15-22(21)36-5-2)37(34,35)31-19-12-10-18(27)11-13-19/h10-16,31H,4-9H2,1-3H3,(H,29,30,33) |
| InChIKey | XWDZMLMBVWZRNY-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 118.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.08 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|