C35H49N5O6S — CID 136657044
2-[5-[2-(3,4-dimethoxyphenyl)ethyl-methyl-sulfinatoazaniumyl]-2-propoxyphenyl]-7-(2-ethylheptyl)-5-methyl-4-oxo-3H-imidazo[5,1-f][1,2,4]triazine (PubChem CID 136657044) has the molecular formula C35H49N5O6S and a molecular weight of 667.87 g/mol. Its IUPAC name is 2-[5-[2-(3,4-dimethoxyphenyl)ethyl-methyl-sulfinatoazaniumyl]-2-propoxyphenyl]-7-(2-ethylheptyl)-5-methyl-4-oxo-3H-imidazo[5,1-f][1,2,4]triazine.
| Compound Name | 2-[5-[2-(3,4-dimethoxyphenyl)ethyl-methyl-sulfinatoazaniumyl]-2-propoxyphenyl]-7-(2-ethylheptyl)-5-methyl-4-oxo-3H-imidazo[5,1-f][1,2,4]triazine |
|---|---|
| PubChem CID | 136657044 |
| Molecular Formula | C35H49N5O6S |
| Molecular Weight | 667.87 g/mol |
| Exact Mass | 667.34 |
| IUPAC Name | 2-[5-[2-(3,4-dimethoxyphenyl)ethyl-methyl-sulfinatoazaniumyl]-2-propoxyphenyl]-7-(2-ethylheptyl)-5-methyl-4-oxo-3H-imidazo[5,1-f][1,2,4]triazine |
| SMILES | CCCCCC(CC)Cc1nc(C)c2c(=O)[nH]c(-c3cc([N+](C)(CCc4ccc(OC)c(OC)c4)S(=O)[O-])ccc3OCCC)nn12 |
| InChI | InChI=1S/C35H49N5O6S/c1-8-11-12-13-25(10-3)22-32-36-24(4)33-35(41)37-34(38-39(32)33)28-23-27(15-17-29(28)46-20-9-2)40(5,47(42)43)19-18-26-14-16-30(44-6)31(21-26)45-7/h14-17,21,23,25H,8-13,18-20,22H2,1-7H3,(H-,37,38,41,42,43) |
| InChIKey | WCMSPERQVAVZFT-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 130.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.87 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|