C13H12N4O — CID 135433598
2-amino-7-benzyl-3,5-dihydropyrrolo[3,2-d]pyrimidin-4-one (PubChem CID 135433598) has the molecular formula C13H12N4O and a molecular weight of 240.27 g/mol. Its IUPAC name is 2-amino-7-benzyl-3,5-dihydropyrrolo[3,2-d]pyrimidin-4-one.
| Compound Name | 2-amino-7-benzyl-3,5-dihydropyrrolo[3,2-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135433598 |
| Molecular Formula | C13H12N4O |
| Molecular Weight | 240.27 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | 2-amino-7-benzyl-3,5-dihydropyrrolo[3,2-d]pyrimidin-4-one |
| SMILES | Nc1nc2c(Cc3ccccc3)c[nH]c2c(=O)[nH]1 |
| InChI | InChI=1S/C13H12N4O/c14-13-16-10-9(6-8-4-2-1-3-5-8)7-15-11(10)12(18)17-13/h1-5,7,15H,6H2,(H3,14,16,17,18) |
| InChIKey | ZBEJFMQAPZKPCM-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 87.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.27 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |