C11H15F2N4O4P — CID 135566455
[5-(2-amino-4-oxo-3,5-dihydropyrrolo[3,2-d]pyrimidin-7-yl)-1,1-difluoropentyl]phosphonic acid (PubChem CID 135566455) has the molecular formula C11H15F2N4O4P and a molecular weight of 336.24 g/mol. Its IUPAC name is [5-(2-amino-4-oxo-3,5-dihydropyrrolo[3,2-d]pyrimidin-7-yl)-1,1-difluoropentyl]phosphonic acid.
| Compound Name | [5-(2-amino-4-oxo-3,5-dihydropyrrolo[3,2-d]pyrimidin-7-yl)-1,1-difluoropentyl]phosphonic acid |
|---|---|
| PubChem CID | 135566455 |
| Molecular Formula | C11H15F2N4O4P |
| Molecular Weight | 336.24 g/mol |
| Exact Mass | 336.08 |
| IUPAC Name | [5-(2-amino-4-oxo-3,5-dihydropyrrolo[3,2-d]pyrimidin-7-yl)-1,1-difluoropentyl]phosphonic acid |
| SMILES | Nc1nc2c(CCCCC(F)(F)P(=O)(O)O)c[nH]c2c(=O)[nH]1 |
| InChI | InChI=1S/C11H15F2N4O4P/c12-11(13,22(19,20)21)4-2-1-3-6-5-15-8-7(6)16-10(14)17-9(8)18/h5,15H,1-4H2,(H2,19,20,21)(H3,14,16,17,18) |
| InChIKey | OISKFAFOKMNXNK-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 145.09 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.24 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|