C13H11N3O — CID 135449028
7-benzyl-3,5-dihydropyrrolo[3,2-d]pyrimidin-4-one (PubChem CID 135449028) has the molecular formula C13H11N3O and a molecular weight of 225.25 g/mol. Its IUPAC name is 7-benzyl-3,5-dihydropyrrolo[3,2-d]pyrimidin-4-one.
| Compound Name | 7-benzyl-3,5-dihydropyrrolo[3,2-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135449028 |
| Molecular Formula | C13H11N3O |
| Molecular Weight | 225.25 g/mol |
| Exact Mass | 225.09 |
| IUPAC Name | 7-benzyl-3,5-dihydropyrrolo[3,2-d]pyrimidin-4-one |
| SMILES | O=c1[nH]cnc2c(Cc3ccccc3)c[nH]c12 |
| InChI | InChI=1S/C13H11N3O/c17-13-12-11(15-8-16-13)10(7-14-12)6-9-4-2-1-3-5-9/h1-5,7-8,14H,6H2,(H,15,16,17) |
| InChIKey | XTZNEYRTGZTVGE-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 61.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.25 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |