C17H14N4O2 — CID 135433669
11-hydroxy-N-phenyl-1,3,8-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8,10-pentaene-10-carboxamide (PubChem CID 135433669) has the molecular formula C17H14N4O2 and a molecular weight of 306.32 g/mol. Its IUPAC name is 11-hydroxy-N-phenyl-1,3,8-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8,10-pentaene-10-carboxamide.
| Compound Name | 11-hydroxy-N-phenyl-1,3,8-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8,10-pentaene-10-carboxamide |
|---|---|
| PubChem CID | 135433669 |
| Molecular Formula | C17H14N4O2 |
| Molecular Weight | 306.32 g/mol |
| Exact Mass | 306.11 |
| IUPAC Name | 11-hydroxy-N-phenyl-1,3,8-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8,10-pentaene-10-carboxamide |
| SMILES | O=C(Nc1ccccc1)C1=C(O)CCn2c1nc1cccnc12 |
| InChI | InChI=1S/C17H14N4O2/c22-13-8-10-21-15-12(7-4-9-18-15)20-16(21)14(13)17(23)19-11-5-2-1-3-6-11/h1-7,9,22H,8,10H2,(H,19,23) |
| InChIKey | WNEQNMGLXTYNEK-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.32 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |